C28H33N5O4 — CID 24789208
3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(2-piperidin-1-ylethylamino)phenyl]propanamide (PubChem CID 24789208) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(2-piperidin-1-ylethylamino)phenyl]propanamide.
| Compound Name | 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(2-piperidin-1-ylethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 24789208 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(2-piperidin-1-ylethylamino)phenyl]propanamide |
| SMILES | NC(=O)CC(NC(=O)Cc1cccc2ccccc12)c1ccc(NCCN2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H33N5O4/c29-27(34)19-25(31-28(35)18-21-9-6-8-20-7-2-3-10-23(20)21)22-11-12-24(26(17-22)33(36)37)30-13-16-32-14-4-1-5-15-32/h2-3,6-12,17,25,30H,1,4-5,13-16,18-19H2,(H2,29,34)(H,31,35) |
| InChIKey | ADEGDMBDJNAQBV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|