C16H19BrN2O5S3 — CID 16582822
4-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 16582822) has the molecular formula C16H19BrN2O5S3 and a molecular weight of 495.44 g/mol. Its IUPAC name is 4-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16582822 |
| Molecular Formula | C16H19BrN2O5S3 |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 493.96 |
| IUPAC Name | 4-bromo-3-methyl-N-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)s2)ccc1Br |
| InChI | InChI=1S/C16H19BrN2O5S3/c1-12-10-14(3-4-15(12)17)26(20,21)18-11-13-2-5-16(25-13)27(22,23)19-6-8-24-9-7-19/h2-5,10,18H,6-9,11H2,1H3 |
| InChIKey | XZWKIJQDMUACHZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |