C17H20N2O7S3 — CID 16621838
methyl 4-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methylsulfamoyl]benzoate (PubChem CID 16621838) has the molecular formula C17H20N2O7S3 and a molecular weight of 460.56 g/mol. Its IUPAC name is methyl 4-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methylsulfamoyl]benzoate.
| Compound Name | methyl 4-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 16621838 |
| Molecular Formula | C17H20N2O7S3 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | methyl 4-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C17H20N2O7S3/c1-25-17(20)13-2-5-15(6-3-13)28(21,22)18-12-14-4-7-16(27-14)29(23,24)19-8-10-26-11-9-19/h2-7,18H,8-12H2,1H3 |
| InChIKey | KLVPULMULRSUCY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |