C19H22N2O7S2 — CID 28632468
methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfamoylmethyl]benzoate (PubChem CID 28632468) has the molecular formula C19H22N2O7S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 28632468 |
| Molecular Formula | C19H22N2O7S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | methyl 4-[(4-morpholin-4-ylsulfonylphenyl)sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O7S2/c1-27-19(22)16-4-2-15(3-5-16)14-29(23,24)20-17-6-8-18(9-7-17)30(25,26)21-10-12-28-13-11-21/h2-9,20H,10-14H2,1H3 |
| InChIKey | BNKSTHFCGJDHTP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |