C18H26N4O2S2 — CID 20947463
1-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonyl-4-piperidin-1-ylpiperidine (PubChem CID 20947463) has the molecular formula C18H26N4O2S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is 1-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonyl-4-piperidin-1-ylpiperidine.
| Compound Name | 1-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonyl-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 20947463 |
| Molecular Formula | C18H26N4O2S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[5-(5-methyl-1H-pyrazol-3-yl)thiophen-2-yl]sulfonyl-4-piperidin-1-ylpiperidine |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)N3CCC(N4CCCCC4)CC3)s2)n[nH]1 |
| InChI | InChI=1S/C18H26N4O2S2/c1-14-13-16(20-19-14)17-5-6-18(25-17)26(23,24)22-11-7-15(8-12-22)21-9-3-2-4-10-21/h5-6,13,15H,2-4,7-12H2,1H3,(H,19,20) |
| InChIKey | YRFVKWLKTRBZOO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |