C8H10FNO5S3 — CID 165460543
5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride (PubChem CID 165460543) has the molecular formula C8H10FNO5S3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride.
| Compound Name | 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride |
|---|---|
| PubChem CID | 165460543 |
| Molecular Formula | C8H10FNO5S3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C8H10FNO5S3/c9-17(11,12)7-1-2-8(16-7)18(13,14)10-3-5-15-6-4-10/h1-2H,3-6H2 |
| InChIKey | KHBKNTFZHONIHK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |