5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride

C8H10FNO5S3 — CID 165460543

IUPAC5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride
SMILESO=S(=O)(F)c1ccc(S(=O)(=O)N2CCOCC2)s1
InChIInChI=1S/C8H10FNO5S3/c9-17(11,12)7-1-2-8(16-7)18(13,14)10-3-5-15-6-4-10/h1-2H,3-6H2
InChIKeyKHBKNTFZHONIHK-UHFFFAOYSA-N
MW315.37 g/mol
LogP0.43
Rot. Bonds3

About 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride

5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride (PubChem CID 165460543) has the molecular formula C8H10FNO5S3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride.

Molecular Properties

Compound Name5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride
PubChem CID165460543
Molecular FormulaC8H10FNO5S3
Molecular Weight315.37 g/mol
Exact Mass314.97
IUPAC Name5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride
SMILESO=S(=O)(F)c1ccc(S(=O)(=O)N2CCOCC2)s1
InChIInChI=1S/C8H10FNO5S3/c9-17(11,12)7-1-2-8(16-7)18(13,14)10-3-5-15-6-4-10/h1-2H,3-6H2
InChIKeyKHBKNTFZHONIHK-UHFFFAOYSA-N
XLogP0.43
TPSA80.75 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.37
LogP ≤ 50.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride?
The IUPAC name of 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride (CID 165460543) is 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride.
What is the SMILES notation for 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride?
The canonical SMILES for 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride is O=S(=O)(F)c1ccc(S(=O)(=O)N2CCOCC2)s1.
What is the InChIKey of 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride?
The InChIKey is KHBKNTFZHONIHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO5S3/c9-17(11,12)7-1-2-8(16-7)18(13,14)10-3-5-15-6-4-10/h1-2H,3-6H2.
What are the key properties of 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride?
5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride has a molecular weight of 315.37 g/mol, XLogP of 0.43, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-morpholin-4-ylsulfonylthiophene-2-sulfonyl fluoride is sourced from PubChem (CID 165460543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).