C12H16N2O5S2 — CID 174855545
N-hydroxy-N-(5-morpholin-4-ylsulfonylthiophen-2-yl)cyclopropanecarboxamide (PubChem CID 174855545) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-hydroxy-N-(5-morpholin-4-ylsulfonylthiophen-2-yl)cyclopropanecarboxamide.
| Compound Name | N-hydroxy-N-(5-morpholin-4-ylsulfonylthiophen-2-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 174855545 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-hydroxy-N-(5-morpholin-4-ylsulfonylthiophen-2-yl)cyclopropanecarboxamide |
| SMILES | O=C(C1CC1)N(O)c1ccc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C12H16N2O5S2/c15-12(9-1-2-9)14(16)10-3-4-11(20-10)21(17,18)13-5-7-19-8-6-13/h3-4,9,16H,1-2,5-8H2 |
| InChIKey | ZXRZOXIKTNKRTK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|