C16H19BrN4O3S — CID 121060936
3-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 121060936) has the molecular formula C16H19BrN4O3S and a molecular weight of 427.32 g/mol. Its IUPAC name is 3-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 121060936 |
| Molecular Formula | C16H19BrN4O3S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 3-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)N1CCN(c2cccnn2)CC1 |
| InChI | InChI=1S/C16H19BrN4O3S/c1-2-24-14-6-5-13(17)12-15(14)25(22,23)21-10-8-20(9-11-21)16-4-3-7-18-19-16/h3-7,12H,2,8-11H2,1H3 |
| InChIKey | XPFWOVKWYJKZON-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |