C23H25BrN4O4S — CID 121035215
4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-phenoxypyrimidine (PubChem CID 121035215) has the molecular formula C23H25BrN4O4S and a molecular weight of 533.45 g/mol. Its IUPAC name is 4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-phenoxypyrimidine.
| Compound Name | 4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-phenoxypyrimidine |
|---|---|
| PubChem CID | 121035215 |
| Molecular Formula | C23H25BrN4O4S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-methyl-6-phenoxypyrimidine |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)N1CCN(c2cc(Oc3ccccc3)nc(C)n2)CC1 |
| InChI | InChI=1S/C23H25BrN4O4S/c1-3-31-20-10-9-18(24)15-21(20)33(29,30)28-13-11-27(12-14-28)22-16-23(26-17(2)25-22)32-19-7-5-4-6-8-19/h4-10,15-16H,3,11-14H2,1-2H3 |
| InChIKey | CKEVOFHRGKXKKJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |