C20H26BrN5O3S — CID 122343998
4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-pyrrolidin-1-ylpyrimidine (PubChem CID 122343998) has the molecular formula C20H26BrN5O3S and a molecular weight of 496.43 g/mol. Its IUPAC name is 4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-pyrrolidin-1-ylpyrimidine.
| Compound Name | 4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 122343998 |
| Molecular Formula | C20H26BrN5O3S |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 4-[4-(5-bromo-2-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-pyrrolidin-1-ylpyrimidine |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)N1CCN(c2ccnc(N3CCCC3)n2)CC1 |
| InChI | InChI=1S/C20H26BrN5O3S/c1-2-29-17-6-5-16(21)15-18(17)30(27,28)26-13-11-24(12-14-26)19-7-8-22-20(23-19)25-9-3-4-10-25/h5-8,15H,2-4,9-14H2,1H3 |
| InChIKey | DCALACWUULXXGK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |