C20H17Cl2IN4O2S — CID 121060769
3-(2,4-dichlorophenyl)-6-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]pyridazine (PubChem CID 121060769) has the molecular formula C20H17Cl2IN4O2S and a molecular weight of 575.26 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-6-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-(2,4-dichlorophenyl)-6-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 121060769 |
| Molecular Formula | C20H17Cl2IN4O2S |
| Molecular Weight | 575.26 g/mol |
| Exact Mass | 573.95 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-6-[4-(4-iodophenyl)sulfonylpiperazin-1-yl]pyridazine |
| SMILES | O=S(=O)(c1ccc(I)cc1)N1CCN(c2ccc(-c3ccc(Cl)cc3Cl)nn2)CC1 |
| InChI | InChI=1S/C20H17Cl2IN4O2S/c21-14-1-6-17(18(22)13-14)19-7-8-20(25-24-19)26-9-11-27(12-10-26)30(28,29)16-4-2-15(23)3-5-16/h1-8,13H,9-12H2 |
| InChIKey | QJJRFQCSTMNVMV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|