C18H20N6O3S — CID 56919524
4-imidazol-1-yl-6-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 56919524) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-imidazol-1-yl-6-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 56919524 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-imidazol-1-yl-6-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | COc1cccc(S(=O)(=O)N2CCN(c3cc(-n4ccnc4)ncn3)CC2)c1 |
| InChI | InChI=1S/C18H20N6O3S/c1-27-15-3-2-4-16(11-15)28(25,26)24-9-7-22(8-10-24)17-12-18(21-13-20-17)23-6-5-19-14-23/h2-6,11-14H,7-10H2,1H3 |
| InChIKey | VUUJKWWACIMISO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |