C25H32N4O4S — CID 21019666
1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methylsulfanyl]piperazine (PubChem CID 21019666) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methylsulfanyl]piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methylsulfanyl]piperazine |
|---|---|
| PubChem CID | 21019666 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methylsulfanyl]piperazine |
| SMILES | c1cc2c(cc1CN1CCN(CSN3CCN(Cc4ccc5c(c4)OCO5)CC3)CC1)OCO2 |
| InChI | InChI=1S/C25H32N4O4S/c1-3-22-24(32-18-30-22)13-20(1)15-26-5-7-28(8-6-26)17-34-29-11-9-27(10-12-29)16-21-2-4-23-25(14-21)33-19-31-23/h1-4,13-14H,5-12,15-19H2 |
| InChIKey | CEILHRIUWIISSA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|