C13H13ClN4O2 — CID 31537868
4-N-[2-(1,3-benzodioxol-5-yl)ethyl]-6-chloropyrimidine-2,4-diamine (PubChem CID 31537868) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 4-N-[2-(1,3-benzodioxol-5-yl)ethyl]-6-chloropyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(1,3-benzodioxol-5-yl)ethyl]-6-chloropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 31537868 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-N-[2-(1,3-benzodioxol-5-yl)ethyl]-6-chloropyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(NCCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H13ClN4O2/c14-11-6-12(18-13(15)17-11)16-4-3-8-1-2-9-10(5-8)20-7-19-9/h1-2,5-6H,3-4,7H2,(H3,15,16,17,18) |
| InChIKey | VYOKMUXMGPOWRE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |