C22H18N4O2 — CID 176893682
4-N-(1,3-benzodioxol-5-ylmethyl)-6-naphthalen-2-ylpyrimidine-2,4-diamine (PubChem CID 176893682) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-6-naphthalen-2-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-naphthalen-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 176893682 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-naphthalen-2-ylpyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccc3c(c2)OCO3)cc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C22H18N4O2/c23-22-25-18(17-7-6-15-3-1-2-4-16(15)10-17)11-21(26-22)24-12-14-5-8-19-20(9-14)28-13-27-19/h1-11H,12-13H2,(H3,23,24,25,26) |
| InChIKey | VUWXSTLMTIJUHA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |