C23H17N3O3 — CID 10872667
N-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]-2-naphthalen-2-ylacetamide (PubChem CID 10872667) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 10872667 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1ccc(-c2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C23H17N3O3/c27-23(12-15-5-6-16-3-1-2-4-17(16)11-15)24-22-10-8-19(25-26-22)18-7-9-20-21(13-18)29-14-28-20/h1-11,13H,12,14H2,(H,24,26,27) |
| InChIKey | IMOWWCPHYDEZQE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |