C19H14N4O5S — CID 7672479
2-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide (PubChem CID 7672479) has the molecular formula C19H14N4O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7672479 |
| Molecular Formula | C19H14N4O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CSc1ccc(-c2ccc3c(c2)OCO3)nn1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N4O5S/c24-18(20-14-3-1-2-4-15(14)23(25)26)10-29-19-8-6-13(21-22-19)12-5-7-16-17(9-12)28-11-27-16/h1-9H,10-11H2,(H,20,24) |
| InChIKey | KZMYLLSLUBRUCC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|