C18H13FN4O3S — CID 7672457
2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide (PubChem CID 7672457) has the molecular formula C18H13FN4O3S and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7672457 |
| Molecular Formula | C18H13FN4O3S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanyl-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CSc1ccc(-c2ccc(F)cc2)nn1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13FN4O3S/c19-13-7-5-12(6-8-13)14-9-10-18(22-21-14)27-11-17(24)20-15-3-1-2-4-16(15)23(25)26/h1-10H,11H2,(H,20,24) |
| InChIKey | CJWXVQJKWMSDIJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|