C18H13F2N3OS — CID 7502831
N-(4-fluorophenyl)-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide (PubChem CID 7502831) has the molecular formula C18H13F2N3OS and a molecular weight of 357.39 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7502831 |
| Molecular Formula | C18H13F2N3OS |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-(4-fluorophenyl)-2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(-c2ccc(F)cc2)nn1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H13F2N3OS/c19-13-3-1-12(2-4-13)16-9-10-18(23-22-16)25-11-17(24)21-15-7-5-14(20)6-8-15/h1-10H,11H2,(H,21,24) |
| InChIKey | VNRVHTFNFQQWQY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |