C20H19N3OS — CID 8541081
N-(4-ethylphenyl)-2-(6-phenylpyridazin-3-yl)sulfanylacetamide (PubChem CID 8541081) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(6-phenylpyridazin-3-yl)sulfanylacetamide.
| Compound Name | N-(4-ethylphenyl)-2-(6-phenylpyridazin-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8541081 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(4-ethylphenyl)-2-(6-phenylpyridazin-3-yl)sulfanylacetamide |
| SMILES | CCc1ccc(NC(=O)CSc2ccc(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C20H19N3OS/c1-2-15-8-10-17(11-9-15)21-19(24)14-25-20-13-12-18(22-23-20)16-6-4-3-5-7-16/h3-13H,2,14H2,1H3,(H,21,24) |
| InChIKey | MTJHDTFKKWCGEU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |