C26H21N3O3S — CID 43936617
methyl 4-[[2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate (PubChem CID 43936617) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is methyl 4-[[2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 43936617 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | methyl 4-[[2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2ccc(-c3ccc(-c4ccccc4)cc3)nn2)cc1 |
| InChI | InChI=1S/C26H21N3O3S/c1-32-26(31)21-11-13-22(14-12-21)27-24(30)17-33-25-16-15-23(28-29-25)20-9-7-19(8-10-20)18-5-3-2-4-6-18/h2-16H,17H2,1H3,(H,27,30) |
| InChIKey | WULPIHOFXUPQNW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |