C26H23N3O2S — CID 43936641
N-(2-methoxy-5-methylphenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide (PubChem CID 43936641) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 43936641 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CSc1ccc(-c2ccc(-c3ccccc3)cc2)nn1 |
| InChI | InChI=1S/C26H23N3O2S/c1-18-8-14-24(31-2)23(16-18)27-25(30)17-32-26-15-13-22(28-29-26)21-11-9-20(10-12-21)19-6-4-3-5-7-19/h3-16H,17H2,1-2H3,(H,27,30) |
| InChIKey | XHUMWOZWJIIKLB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |