C24H17FN4O3S — CID 43936697
N-(4-fluoro-3-nitrophenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide (PubChem CID 43936697) has the molecular formula C24H17FN4O3S and a molecular weight of 460.49 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 43936697 |
| Molecular Formula | C24H17FN4O3S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2-[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(-c2ccc(-c3ccccc3)cc2)nn1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17FN4O3S/c25-20-11-10-19(14-22(20)29(31)32)26-23(30)15-33-24-13-12-21(27-28-24)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-14H,15H2,(H,26,30) |
| InChIKey | PACOQHKKHRCGRG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|