C21H18FN3O3S — CID 8543081
ethyl 2-[[2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate (PubChem CID 8543081) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is ethyl 2-[[2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 8543081 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | ethyl 2-[[2-[6-(4-fluorophenyl)pyridazin-3-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CSc1ccc(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C21H18FN3O3S/c1-2-28-21(27)16-5-3-4-6-18(16)23-19(26)13-29-20-12-11-17(24-25-20)14-7-9-15(22)10-8-14/h3-12H,2,13H2,1H3,(H,23,26) |
| InChIKey | DOWWBUKNNKMMBK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |