C20H18N4O3 — CID 113050236
N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]-3-phenylpropanamide (PubChem CID 113050236) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]-3-phenylpropanamide.
| Compound Name | N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 113050236 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(Nc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C20H18N4O3/c25-20(11-6-14-4-2-1-3-5-14)22-19-10-9-18(23-24-19)21-15-7-8-16-17(12-15)27-13-26-16/h1-5,7-10,12H,6,11,13H2,(H,21,23)(H,22,24,25) |
| InChIKey | FLQRZOSQXMFGBV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |