C15H16N4O3 — CID 113050204
N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]butanamide (PubChem CID 113050204) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]butanamide.
| Compound Name | N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]butanamide |
|---|---|
| PubChem CID | 113050204 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Nc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C15H16N4O3/c1-2-3-15(20)17-14-7-6-13(18-19-14)16-10-4-5-11-12(8-10)22-9-21-11/h4-8H,2-3,9H2,1H3,(H,16,18)(H,17,19,20) |
| InChIKey | HYAPFLOCPZALCA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |