C13H14N4O4S — CID 113050265
N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]ethanesulfonamide (PubChem CID 113050265) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]ethanesulfonamide.
| Compound Name | N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 113050265 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[6-(1,3-benzodioxol-5-ylamino)pyridazin-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Nc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C13H14N4O4S/c1-2-22(18,19)17-13-6-5-12(15-16-13)14-9-3-4-10-11(7-9)21-8-20-10/h3-7H,2,8H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | HEOALTDOSVNLJG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |