C14H17N5O3S — CID 113049321
N-[4-[[6-(ethylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide (PubChem CID 113049321) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-[4-[[6-(ethylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-(ethylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 113049321 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[4-[[6-(ethylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Nc2ccc(NC(C)=O)cc2)nn1 |
| InChI | InChI=1S/C14H17N5O3S/c1-3-23(21,22)19-14-9-8-13(17-18-14)16-12-6-4-11(5-7-12)15-10(2)20/h4-9H,3H2,1-2H3,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | XAIGTPYKQNGXKY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |