C16H21N5O3S — CID 113049323
N-[4-[[6-(butylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide (PubChem CID 113049323) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[4-[[6-(butylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-(butylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 113049323 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[4-[[6-(butylsulfonylamino)pyridazin-3-yl]amino]phenyl]acetamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(Nc2ccc(NC(C)=O)cc2)nn1 |
| InChI | InChI=1S/C16H21N5O3S/c1-3-4-11-25(23,24)21-16-10-9-15(19-20-16)18-14-7-5-13(6-8-14)17-12(2)22/h5-10H,3-4,11H2,1-2H3,(H,17,22)(H,18,19)(H,20,21) |
| InChIKey | GCOMBFKDXVGHJJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |