C15H19N3O3 — CID 163343919
5-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine (PubChem CID 163343919) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163343919 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine |
| SMILES | COCCNc1ncc(-c2ccc(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C15H19N3O3/c1-19-7-6-16-15-17-9-12(10-18-15)11-4-5-13(20-2)14(8-11)21-3/h4-5,8-10H,6-7H2,1-3H3,(H,16,17,18) |
| InChIKey | HKDWOFMFHDJFHQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|