C18H22N2O4 — CID 134811148
4-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-2,3-dihydrofuro[2,3-c]pyridin-7-amine (PubChem CID 134811148) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-2,3-dihydrofuro[2,3-c]pyridin-7-amine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-2,3-dihydrofuro[2,3-c]pyridin-7-amine |
|---|---|
| PubChem CID | 134811148 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-(2-methoxyethyl)-2,3-dihydrofuro[2,3-c]pyridin-7-amine |
| SMILES | COCCNc1ncc(-c2ccc(OC)c(OC)c2)c2c1OCC2 |
| InChI | InChI=1S/C18H22N2O4/c1-21-9-7-19-18-17-13(6-8-24-17)14(11-20-18)12-4-5-15(22-2)16(10-12)23-3/h4-5,10-11H,6-9H2,1-3H3,(H,19,20) |
| InChIKey | CJGZWYYUSJTWEZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|