C12H17ClFN3O3S — CID 103052009
3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide (PubChem CID 103052009) has the molecular formula C12H17ClFN3O3S and a molecular weight of 337.80 g/mol. Its IUPAC name is 3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 103052009 |
| Molecular Formula | C12H17ClFN3O3S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-[(3-amino-5-chloro-2-fluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCNS(=O)(=O)c1cc(Cl)cc(N)c1F |
| InChI | InChI=1S/C12H17ClFN3O3S/c1-7(2)17-11(18)3-4-16-21(19,20)10-6-8(13)5-9(15)12(10)14/h5-7,16H,3-4,15H2,1-2H3,(H,17,18) |
| InChIKey | DPGALYAYBOTLLR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|