C10H11F3N2O2S2 — CID 61119447
2-methyl-2-[(2,4,6-trifluorophenyl)sulfonylamino]propanethioamide (PubChem CID 61119447) has the molecular formula C10H11F3N2O2S2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-methyl-2-[(2,4,6-trifluorophenyl)sulfonylamino]propanethioamide.
| Compound Name | 2-methyl-2-[(2,4,6-trifluorophenyl)sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 61119447 |
| Molecular Formula | C10H11F3N2O2S2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-methyl-2-[(2,4,6-trifluorophenyl)sulfonylamino]propanethioamide |
| SMILES | CC(C)(NS(=O)(=O)c1c(F)cc(F)cc1F)C(N)=S |
| InChI | InChI=1S/C10H11F3N2O2S2/c1-10(2,9(14)18)15-19(16,17)8-6(12)3-5(11)4-7(8)13/h3-4,15H,1-2H3,(H2,14,18) |
| InChIKey | LFUSNMOGDOCGEU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|