C10H12Br2N2O2S2 — CID 61119645
2-[(2,5-dibromophenyl)sulfonylamino]-2-methylpropanethioamide (PubChem CID 61119645) has the molecular formula C10H12Br2N2O2S2 and a molecular weight of 416.16 g/mol. Its IUPAC name is 2-[(2,5-dibromophenyl)sulfonylamino]-2-methylpropanethioamide.
| Compound Name | 2-[(2,5-dibromophenyl)sulfonylamino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 61119645 |
| Molecular Formula | C10H12Br2N2O2S2 |
| Molecular Weight | 416.16 g/mol |
| Exact Mass | 413.87 |
| IUPAC Name | 2-[(2,5-dibromophenyl)sulfonylamino]-2-methylpropanethioamide |
| SMILES | CC(C)(NS(=O)(=O)c1cc(Br)ccc1Br)C(N)=S |
| InChI | InChI=1S/C10H12Br2N2O2S2/c1-10(2,9(13)17)14-18(15,16)8-5-6(11)3-4-7(8)12/h3-5,14H,1-2H3,(H2,13,17) |
| InChIKey | UZVYOHBMWZFPPB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|