C8H5F3N2O2S — CID 60972331
N-(cyanomethyl)-2,4,6-trifluorobenzenesulfonamide (PubChem CID 60972331) has the molecular formula C8H5F3N2O2S and a molecular weight of 250.20 g/mol. Its IUPAC name is N-(cyanomethyl)-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-(cyanomethyl)-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60972331 |
| Molecular Formula | C8H5F3N2O2S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | N-(cyanomethyl)-2,4,6-trifluorobenzenesulfonamide |
| SMILES | N#CCNS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C8H5F3N2O2S/c9-5-3-6(10)8(7(11)4-5)16(14,15)13-2-1-12/h3-4,13H,2H2 |
| InChIKey | SIEYQPXILUJUFQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|