C10H15F2N3O4S2 — CID 106333567
4-amino-N-[2-(dimethylsulfamoyl)ethyl]-2,6-difluorobenzenesulfonamide (PubChem CID 106333567) has the molecular formula C10H15F2N3O4S2 and a molecular weight of 343.38 g/mol. Its IUPAC name is 4-amino-N-[2-(dimethylsulfamoyl)ethyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-amino-N-[2-(dimethylsulfamoyl)ethyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106333567 |
| Molecular Formula | C10H15F2N3O4S2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-amino-N-[2-(dimethylsulfamoyl)ethyl]-2,6-difluorobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C10H15F2N3O4S2/c1-15(2)20(16,17)4-3-14-21(18,19)10-8(11)5-7(13)6-9(10)12/h5-6,14H,3-4,13H2,1-2H3 |
| InChIKey | HMIATEMBEJSLQD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|