C10H13F2NO5S2 — CID 166188133
2,6-difluoro-4-methoxy-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 166188133) has the molecular formula C10H13F2NO5S2 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2,6-difluoro-4-methoxy-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 2,6-difluoro-4-methoxy-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166188133 |
| Molecular Formula | C10H13F2NO5S2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2,6-difluoro-4-methoxy-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | COc1cc(F)c(S(=O)(=O)NCCS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C10H13F2NO5S2/c1-18-7-5-8(11)10(9(12)6-7)20(16,17)13-3-4-19(2,14)15/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | HMAQZJXGPULMTB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |