C11H18FN3O4S2 — CID 106335923
2-(aminomethyl)-N-[2-(dimethylsulfamoyl)ethyl]-3-fluorobenzenesulfonamide (PubChem CID 106335923) has the molecular formula C11H18FN3O4S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(dimethylsulfamoyl)ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | 2-(aminomethyl)-N-[2-(dimethylsulfamoyl)ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106335923 |
| Molecular Formula | C11H18FN3O4S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(dimethylsulfamoyl)ethyl]-3-fluorobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNS(=O)(=O)c1cccc(F)c1CN |
| InChI | InChI=1S/C11H18FN3O4S2/c1-15(2)20(16,17)7-6-14-21(18,19)11-5-3-4-10(12)9(11)8-13/h3-5,14H,6-8,13H2,1-2H3 |
| InChIKey | GDODEJWKAOUXNW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |