C10H15Cl2N3O4S2 — CID 106333613
3-amino-2,4-dichloro-N-[2-(dimethylsulfamoyl)ethyl]benzenesulfonamide (PubChem CID 106333613) has the molecular formula C10H15Cl2N3O4S2 and a molecular weight of 376.29 g/mol. Its IUPAC name is 3-amino-2,4-dichloro-N-[2-(dimethylsulfamoyl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-2,4-dichloro-N-[2-(dimethylsulfamoyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106333613 |
| Molecular Formula | C10H15Cl2N3O4S2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 3-amino-2,4-dichloro-N-[2-(dimethylsulfamoyl)ethyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNS(=O)(=O)c1ccc(Cl)c(N)c1Cl |
| InChI | InChI=1S/C10H15Cl2N3O4S2/c1-15(2)20(16,17)6-5-14-21(18,19)8-4-3-7(11)10(13)9(8)12/h3-4,14H,5-6,13H2,1-2H3 |
| InChIKey | LGBJMFYMXIZUHW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|