C9H14ClN3O4S2 — CID 106336289
4-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridine-3-sulfonamide (PubChem CID 106336289) has the molecular formula C9H14ClN3O4S2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 4-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 4-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106336289 |
| Molecular Formula | C9H14ClN3O4S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-chloro-N-[2-(dimethylsulfamoyl)ethyl]pyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNS(=O)(=O)c1cnccc1Cl |
| InChI | InChI=1S/C9H14ClN3O4S2/c1-13(2)18(14,15)6-5-12-19(16,17)9-7-11-4-3-8(9)10/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | DXWKMFPYVVRBMT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |