C12H20N2O5S — CID 104551545
4-[1-hydroxypropan-2-yl(methyl)sulfamoyl]-1-propylpyrrole-2-carboxylic acid (PubChem CID 104551545) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[1-hydroxypropan-2-yl(methyl)sulfamoyl]-1-propylpyrrole-2-carboxylic acid.
| Compound Name | 4-[1-hydroxypropan-2-yl(methyl)sulfamoyl]-1-propylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 104551545 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[1-hydroxypropan-2-yl(methyl)sulfamoyl]-1-propylpyrrole-2-carboxylic acid |
| SMILES | CCCn1cc(S(=O)(=O)N(C)C(C)CO)cc1C(=O)O |
| InChI | InChI=1S/C12H20N2O5S/c1-4-5-14-7-10(6-11(14)12(16)17)20(18,19)13(3)9(2)8-15/h6-7,9,15H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | UNGNOHNTRNCIBQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |