C11H18N2O4S2 — CID 112658017
1-methyl-4-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid (PubChem CID 112658017) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-methyl-4-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-methyl-4-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 112658017 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-methyl-4-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1cc(C(=O)O)n(C)c1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-8(7-18-4)13(3)19(16,17)9-5-10(11(14)15)12(2)6-9/h5-6,8H,7H2,1-4H3,(H,14,15) |
| InChIKey | RAHCPQWFQWAIPQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |