C9H10FN5O2S2 — CID 107326285
3-amino-4-fluoro-2,6-dimethyl-N-(thiatriazol-5-yl)benzenesulfonamide (PubChem CID 107326285) has the molecular formula C9H10FN5O2S2 and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-amino-4-fluoro-2,6-dimethyl-N-(thiatriazol-5-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-2,6-dimethyl-N-(thiatriazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107326285 |
| Molecular Formula | C9H10FN5O2S2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-amino-4-fluoro-2,6-dimethyl-N-(thiatriazol-5-yl)benzenesulfonamide |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)Nc1nnns1 |
| InChI | InChI=1S/C9H10FN5O2S2/c1-4-3-6(10)7(11)5(2)8(4)19(16,17)13-9-12-14-15-18-9/h3H,11H2,1-2H3,(H,12,13,15) |
| InChIKey | ZIZPURGQZOQZIH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|