C8H9N7O4S2 — CID 114912915
4-hydrazinyl-2-methyl-5-nitro-N-(thiatriazol-5-yl)benzenesulfonamide (PubChem CID 114912915) has the molecular formula C8H9N7O4S2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 4-hydrazinyl-2-methyl-5-nitro-N-(thiatriazol-5-yl)benzenesulfonamide.
| Compound Name | 4-hydrazinyl-2-methyl-5-nitro-N-(thiatriazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114912915 |
| Molecular Formula | C8H9N7O4S2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 4-hydrazinyl-2-methyl-5-nitro-N-(thiatriazol-5-yl)benzenesulfonamide |
| SMILES | Cc1cc(NN)c([N+](=O)[O-])cc1S(=O)(=O)Nc1nnns1 |
| InChI | InChI=1S/C8H9N7O4S2/c1-4-2-5(10-9)6(15(16)17)3-7(4)21(18,19)12-8-11-13-14-20-8/h2-3,10H,9H2,1H3,(H,11,12,14) |
| InChIKey | LVFLDWUROWTHOU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 166.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|