C14H20F3N3O3S — CID 113150231
2-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 113150231) has the molecular formula C14H20F3N3O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 113150231 |
| Molecular Formula | C14H20F3N3O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[3-(dimethylamino)propyl-methylsulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(C)CCCN(CC(=O)Nc1ccc(F)c(F)c1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H20F3N3O3S/c1-19(2)7-4-8-20(24(3,22)23)9-12(21)18-11-6-5-10(15)13(16)14(11)17/h5-6H,4,7-9H2,1-3H3,(H,18,21) |
| InChIKey | SVODJBPZFHFHDT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|