C12H14F3NO4S — CID 61009932
methyl 3-[ethyl-(2,3,4-trifluorophenyl)sulfonylamino]propanoate (PubChem CID 61009932) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is methyl 3-[ethyl-(2,3,4-trifluorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[ethyl-(2,3,4-trifluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 61009932 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | methyl 3-[ethyl-(2,3,4-trifluorophenyl)sulfonylamino]propanoate |
| SMILES | CCN(CCC(=O)OC)S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H14F3NO4S/c1-3-16(7-6-10(17)20-2)21(18,19)9-5-4-8(13)11(14)12(9)15/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | OYOAYUVEFQJUFX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|