C22H18ClF3N2O4S — CID 28547418
2-(4-chloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 28547418) has the molecular formula C22H18ClF3N2O4S and a molecular weight of 498.91 g/mol. Its IUPAC name is 2-(4-chloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(4-chloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 28547418 |
| Molecular Formula | C22H18ClF3N2O4S |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 2-(4-chloro-N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)Nc1ccc(F)c(F)c1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClF3N2O4S/c1-13-3-10-18(32-2)19(11-13)33(30,31)28(15-6-4-14(23)5-7-15)12-20(29)27-17-9-8-16(24)21(25)22(17)26/h3-11H,12H2,1-2H3,(H,27,29) |
| InChIKey | GFFPUHHYYHOWQS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|