C25H27N3O5S — CID 126393004
N-(4-acetamidophenyl)-2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 126393004) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 126393004 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)Nc1ccc(NC(C)=O)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H27N3O5S/c1-17-5-12-22(13-6-17)28(34(31,32)24-15-18(2)7-14-23(24)33-4)16-25(30)27-21-10-8-20(9-11-21)26-19(3)29/h5-15H,16H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | ITVONLIFCBZFKW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |