C24H25N3O5S — CID 126394467
4-[[2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetyl]amino]benzamide (PubChem CID 126394467) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[[2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 126394467 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 4-[[2-(N-(2-methoxy-5-methylphenyl)sulfonyl-4-methylanilino)acetyl]amino]benzamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)Nc1ccc(C(N)=O)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-16-4-11-20(12-5-16)27(33(30,31)22-14-17(2)6-13-21(22)32-3)15-23(28)26-19-9-7-18(8-10-19)24(25)29/h4-14H,15H2,1-3H3,(H2,25,29)(H,26,28) |
| InChIKey | QWUSFEZTRCCOHR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |