C24H22ClN3O4S3 — CID 2267443
2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]acetamide (PubChem CID 2267443) has the molecular formula C24H22ClN3O4S3 and a molecular weight of 548.11 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 2267443 |
| Molecular Formula | C24H22ClN3O4S3 |
| Molecular Weight | 548.11 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NCCSc1nc2ccccc2s1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22ClN3O4S3/c1-32-21-12-11-17(25)15-20(21)28(35(30,31)18-7-3-2-4-8-18)16-23(29)26-13-14-33-24-27-19-9-5-6-10-22(19)34-24/h2-12,15H,13-14,16H2,1H3,(H,26,29) |
| InChIKey | IDLFHZLRXZPKEE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.11 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|